C19H26O6 — CID 162935699
[(1S,5S,6R,7S,10R,11R,13S)-7-hydroxy-7,11-dimethyl-2-methylidene-3-oxo-4,14-dioxatetracyclo[9.2.1.01,5.06,10]tetradecan-13-yl] 2-methylpropanoate (PubChem CID 162935699) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1S,5S,6R,7S,10R,11R,13S)-7-hydroxy-7,11-dimethyl-2-methylidene-3-oxo-4,14-dioxatetracyclo[9.2.1.01,5.06,10]tetradecan-13-yl] 2-methylpropanoate.
| Compound Name | [(1S,5S,6R,7S,10R,11R,13S)-7-hydroxy-7,11-dimethyl-2-methylidene-3-oxo-4,14-dioxatetracyclo[9.2.1.01,5.06,10]tetradecan-13-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162935699 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(1S,5S,6R,7S,10R,11R,13S)-7-hydroxy-7,11-dimethyl-2-methylidene-3-oxo-4,14-dioxatetracyclo[9.2.1.01,5.06,10]tetradecan-13-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]3[C@@H](CC[C@]3(C)O)[C@@]3(C)C[C@H](OC(=O)C(C)C)[C@@]12O3 |
| InChI | InChI=1S/C19H26O6/c1-9(2)15(20)23-12-8-18(5)11-6-7-17(4,22)13(11)14-19(12,25-18)10(3)16(21)24-14/h9,11-14,22H,3,6-8H2,1-2,4-5H3/t11-,12+,13-,14+,17+,18-,19+/m1/s1 |
| InChIKey | PNXOKYDGXZDHHY-ZIKUBBOKSA-N |
| XLogP | 1.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|