C22H42O7 — CID 162935717
(E,4S,8R,11S,12S,13R,15S,16R)-8,11,12,13,15,16-hexahydroxy-4,8,12,16-tetramethyloctadec-5-en-7-one (PubChem CID 162935717) has the molecular formula C22H42O7 and a molecular weight of 418.57 g/mol. Its IUPAC name is (E,4S,8R,11S,12S,13R,15S,16R)-8,11,12,13,15,16-hexahydroxy-4,8,12,16-tetramethyloctadec-5-en-7-one.
| Compound Name | (E,4S,8R,11S,12S,13R,15S,16R)-8,11,12,13,15,16-hexahydroxy-4,8,12,16-tetramethyloctadec-5-en-7-one |
|---|---|
| PubChem CID | 162935717 |
| Molecular Formula | C22H42O7 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (E,4S,8R,11S,12S,13R,15S,16R)-8,11,12,13,15,16-hexahydroxy-4,8,12,16-tetramethyloctadec-5-en-7-one |
| SMILES | CCC[C@H](C)/C=C/C(=O)[C@](C)(O)CC[C@H](O)[C@](C)(O)[C@H](O)C[C@H](O)[C@](C)(O)CC |
| InChI | InChI=1S/C22H42O7/c1-7-9-15(3)10-11-16(23)21(5,28)13-12-17(24)22(6,29)19(26)14-18(25)20(4,27)8-2/h10-11,15,17-19,24-29H,7-9,12-14H2,1-6H3/b11-10+/t15-,17-,18-,19+,20+,21+,22-/m0/s1 |
| InChIKey | ROJKRLZBQTVDQH-OTOXSGAJSA-N |
| XLogP | 1.46 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|