C18H26O4 — CID 162935736
methyl (6S,8S,8aR)-6-acetyloxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate (PubChem CID 162935736) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is methyl (6S,8S,8aR)-6-acetyloxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl (6S,8S,8aR)-6-acetyloxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 162935736 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | methyl (6S,8S,8aR)-6-acetyloxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2C(=C(C)[C@@H](OC(C)=O)C[C@H]2C(C)C)CC1 |
| InChI | InChI=1S/C18H26O4/c1-10(2)15-9-17(22-12(4)19)11(3)14-7-6-13(8-16(14)15)18(20)21-5/h8,10,15-17H,6-7,9H2,1-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | WCOZBLGMBYYKTP-BBWFWOEESA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|