C34H31NO12 — CID 162935815
(2R,3R)-2-[(E)-3-[2-[(E)-2-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]ethenyl]-4,5-dihydroxyphenyl]prop-2-enoyl]oxy-4-(methylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid (PubChem CID 162935815) has the molecular formula C34H31NO12 and a molecular weight of 645.62 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-3-[2-[(E)-2-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]ethenyl]-4,5-dihydroxyphenyl]prop-2-enoyl]oxy-4-(methylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid.
| Compound Name | (2R,3R)-2-[(E)-3-[2-[(E)-2-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]ethenyl]-4,5-dihydroxyphenyl]prop-2-enoyl]oxy-4-(methylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 162935815 |
| Molecular Formula | C34H31NO12 |
| Molecular Weight | 645.62 g/mol |
| Exact Mass | 645.18 |
| IUPAC Name | (2R,3R)-2-[(E)-3-[2-[(E)-2-[4,5-dihydroxy-2-(3-hydroxyphenyl)phenyl]ethenyl]-4,5-dihydroxyphenyl]prop-2-enoyl]oxy-4-(methylamino)-3-(3,4,5-trihydroxyphenyl)butanoic acid |
| SMILES | CNC[C@@H](c1cc(O)c(O)c(O)c1)[C@@H](OC(=O)/C=C/c1cc(O)c(O)cc1/C=C/c1cc(O)c(O)cc1-c1cccc(O)c1)C(=O)O |
| InChI | InChI=1S/C34H31NO12/c1-35-16-24(21-13-29(41)32(44)30(42)14-21)33(34(45)46)47-31(43)8-7-18-11-26(38)25(37)10-17(18)5-6-20-12-27(39)28(40)15-23(20)19-3-2-4-22(36)9-19/h2-15,24,33,35-42,44H,16H2,1H3,(H,45,46)/b6-5+,8-7+/t24-,33+/m0/s1 |
| InChIKey | WFUZAJQDKFLIRT-MKUUUYKZSA-N |
| XLogP | 4.18 |
| TPSA | 237.47 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|