C10H17Br3Cl2O — CID 162935992
(2S,3R,4S,6R)-1,4,6-tribromo-3,7-dichloro-3,7-dimethyloctan-2-ol (PubChem CID 162935992) has the molecular formula C10H17Br3Cl2O and a molecular weight of 463.86 g/mol. Its IUPAC name is (2S,3R,4S,6R)-1,4,6-tribromo-3,7-dichloro-3,7-dimethyloctan-2-ol.
| Compound Name | (2S,3R,4S,6R)-1,4,6-tribromo-3,7-dichloro-3,7-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 162935992 |
| Molecular Formula | C10H17Br3Cl2O |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 459.82 |
| IUPAC Name | (2S,3R,4S,6R)-1,4,6-tribromo-3,7-dichloro-3,7-dimethyloctan-2-ol |
| SMILES | CC(C)(Cl)[C@H](Br)C[C@H](Br)[C@](C)(Cl)[C@H](O)CBr |
| InChI | InChI=1S/C10H17Br3Cl2O/c1-9(2,14)6(12)4-7(13)10(3,15)8(16)5-11/h6-8,16H,4-5H2,1-3H3/t6-,7+,8-,10+/m1/s1 |
| InChIKey | XFGLYIOWLVXLGD-JIOCBJNQSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|