C73H78N2O12 — CID 162936693
CID 162936693 (PubChem CID 162936693) has the molecular formula C73H78N2O12 and a molecular weight of 1175.43 g/mol.
| Compound Name | CID 162936693 |
|---|---|
| PubChem CID | 162936693 |
| Molecular Formula | C73H78N2O12 |
| Molecular Weight | 1175.43 g/mol |
| Exact Mass | 1174.56 |
| IUPAC Name | — |
| SMILES | COc1c2c3c4c(O)c(c5c6c4c1CCC6=CC1CCCC51)C(=O)CN1Cc4c(cccc4C1=O)CC#COC1C(O)C(COC(c4c[nH]c5cc6c7c(c45)CC4(CCC5(CCCC5)C4)CC4CC5CCCC5(O)CC74CC6)C=C2)OC(O3)C1(O)CO |
| InChI | InChI=1S/C73H78N2O12/c1-83-64-46-15-14-40-26-39-9-5-12-44(39)57-55(40)58(46)60-63(79)59(57)52(77)33-75-32-50-38(8-4-13-45(50)67(75)80)10-7-25-84-66-62(78)54-34-85-53(17-16-47(64)65(60)87-68(86-54)73(66,82)37-76)49-31-74-51-27-41-18-22-71-36-72(81)21-6-11-42(72)28-43(71)29-70(30-48(56(49)51)61(41)71)24-23-69(35-70)19-2-3-20-69/h4,8,13,16-17,26-27,31,39,42-44,53-54,62,66,68,74,76,78-79,81-82H,2-3,5-6,9-12,14-15,18-24,28-30,32-37H2,1H3 |
| InChIKey | JNPGSMJYSDPKSD-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 200.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 87 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.43 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|