C21H38O6 — CID 162937063
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,6S)-6-nonylcyclohex-2-en-1-yl]oxyoxane-3,4,5-triol (PubChem CID 162937063) has the molecular formula C21H38O6 and a molecular weight of 386.53 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,6S)-6-nonylcyclohex-2-en-1-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,6S)-6-nonylcyclohex-2-en-1-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 162937063 |
| Molecular Formula | C21H38O6 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,6S)-6-nonylcyclohex-2-en-1-yl]oxyoxane-3,4,5-triol |
| SMILES | CCCCCCCCC[C@H]1CCC=C[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H38O6/c1-2-3-4-5-6-7-8-11-15-12-9-10-13-16(15)26-21-20(25)19(24)18(23)17(14-22)27-21/h10,13,15-25H,2-9,11-12,14H2,1H3/t15-,16-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | UMZTUZCMBMNJSZ-UMKHLJCSSA-N |
| XLogP | 2.28 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|