C20H34O2 — CID 162937173
(1S,4S,4aR,8aS)-4-[(3S)-3-hydroxyhex-5-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-ol (PubChem CID 162937173) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,4S,4aR,8aS)-4-[(3S)-3-hydroxyhex-5-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-ol.
| Compound Name | (1S,4S,4aR,8aS)-4-[(3S)-3-hydroxyhex-5-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-ol |
|---|---|
| PubChem CID | 162937173 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,4S,4aR,8aS)-4-[(3S)-3-hydroxyhex-5-enyl]-4a,8,8-trimethyl-3-methylidene-2,4,5,6,7,8a-hexahydro-1H-naphthalen-1-ol |
| SMILES | C=CC[C@@H](O)CC[C@H]1C(=C)C[C@H](O)[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C20H34O2/c1-6-8-15(21)9-10-16-14(2)13-17(22)18-19(3,4)11-7-12-20(16,18)5/h6,15-18,21-22H,1-2,7-13H2,3-5H3/t15-,16+,17+,18+,20-/m1/s1 |
| InChIKey | OFUDNTAMPZZAGY-AISVETHESA-N |
| XLogP | 4.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|