C33H46O — CID 162937250
3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(3-methylbutyl)phenyl]methyl]phenol (PubChem CID 162937250) has the molecular formula C33H46O and a molecular weight of 458.73 g/mol. Its IUPAC name is 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(3-methylbutyl)phenyl]methyl]phenol.
| Compound Name | 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(3-methylbutyl)phenyl]methyl]phenol |
|---|---|
| PubChem CID | 162937250 |
| Molecular Formula | C33H46O |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | 3-[[(1S,3S)-3-[(1S,5S)-1,5-dimethylcyclohex-2-en-1-yl]cyclohexyl]methyl]-5-[[2-(3-methylbutyl)phenyl]methyl]phenol |
| SMILES | CC(C)CCc1ccccc1Cc1cc(O)cc(C[C@H]2CCC[C@H]([C@@]3(C)C=CC[C@H](C)C3)C2)c1 |
| InChI | InChI=1S/C33H46O/c1-24(2)14-15-29-11-5-6-12-30(29)19-28-18-27(21-32(34)22-28)17-26-10-7-13-31(20-26)33(4)16-8-9-25(3)23-33/h5-6,8,11-12,16,18,21-22,24-26,31,34H,7,9-10,13-15,17,19-20,23H2,1-4H3/t25-,26+,31-,33-/m0/s1 |
| InChIKey | DREGGGCADZQCPY-AOHYXGPVSA-N |
| XLogP | 8.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|