C16H38O5Si3 — CID 162937304
trimethylsilyl (2S)-3-[(2R)-2,3-bis(trimethylsilyloxy)propoxy]-2-methylpropanoate (PubChem CID 162937304) has the molecular formula C16H38O5Si3 and a molecular weight of 394.73 g/mol. Its IUPAC name is trimethylsilyl (2S)-3-[(2R)-2,3-bis(trimethylsilyloxy)propoxy]-2-methylpropanoate.
| Compound Name | trimethylsilyl (2S)-3-[(2R)-2,3-bis(trimethylsilyloxy)propoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 162937304 |
| Molecular Formula | C16H38O5Si3 |
| Molecular Weight | 394.73 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | trimethylsilyl (2S)-3-[(2R)-2,3-bis(trimethylsilyloxy)propoxy]-2-methylpropanoate |
| SMILES | C[C@@H](COC[C@H](CO[Si](C)(C)C)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H38O5Si3/c1-14(16(17)21-24(8,9)10)11-18-12-15(20-23(5,6)7)13-19-22(2,3)4/h14-15H,11-13H2,1-10H3/t14-,15+/m0/s1 |
| InChIKey | YTNMLZVAADXGMA-LSDHHAIUSA-N |
| XLogP | 4.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|