C20H24O7 — CID 162937348
(1S,3R,7Z,9R,12S,13R,15R)-13-[(E)-but-2-en-2-yl]-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadeca-5,7-diene-4,11-dione (PubChem CID 162937348) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1S,3R,7Z,9R,12S,13R,15R)-13-[(E)-but-2-en-2-yl]-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadeca-5,7-diene-4,11-dione.
| Compound Name | (1S,3R,7Z,9R,12S,13R,15R)-13-[(E)-but-2-en-2-yl]-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadeca-5,7-diene-4,11-dione |
|---|---|
| PubChem CID | 162937348 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1S,3R,7Z,9R,12S,13R,15R)-13-[(E)-but-2-en-2-yl]-13-hydroxy-7-(hydroxymethyl)-3,12-dimethyl-10,14,16-trioxatetracyclo[7.5.1.13,6.012,15]hexadeca-5,7-diene-4,11-dione |
| SMILES | C/C=C(\C)[C@@]1(O)O[C@H]2C[C@@]3(C)OC(=CC3=O)/C(CO)=C\[C@H]3OC(=O)[C@@]1(C)[C@H]23 |
| InChI | InChI=1S/C20H24O7/c1-5-10(2)20(24)19(4)16-13(25-17(19)23)6-11(9-21)12-7-15(22)18(3,26-12)8-14(16)27-20/h5-7,13-14,16,21,24H,8-9H2,1-4H3/b10-5+,11-6-/t13-,14+,16+,18-,19-,20-/m1/s1 |
| InChIKey | AIZNIOVNQXYELM-ICOBNEJZSA-N |
| XLogP | 1.15 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|