C33H46O7 — CID 162937472
[(1S,2S,3S,4R,7R,8R,16S,17S,19R,21S)-1-methoxy-2,4,7,12,12,17,22,22-octamethyl-6,11-dioxo-20,23-dioxahexacyclo[19.2.1.03,19.04,17.07,16.08,13]tetracosa-9,13-dien-10-yl] acetate (PubChem CID 162937472) has the molecular formula C33H46O7 and a molecular weight of 554.72 g/mol. Its IUPAC name is [(1S,2S,3S,4R,7R,8R,16S,17S,19R,21S)-1-methoxy-2,4,7,12,12,17,22,22-octamethyl-6,11-dioxo-20,23-dioxahexacyclo[19.2.1.03,19.04,17.07,16.08,13]tetracosa-9,13-dien-10-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,7R,8R,16S,17S,19R,21S)-1-methoxy-2,4,7,12,12,17,22,22-octamethyl-6,11-dioxo-20,23-dioxahexacyclo[19.2.1.03,19.04,17.07,16.08,13]tetracosa-9,13-dien-10-yl] acetate |
|---|---|
| PubChem CID | 162937472 |
| Molecular Formula | C33H46O7 |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | [(1S,2S,3S,4R,7R,8R,16S,17S,19R,21S)-1-methoxy-2,4,7,12,12,17,22,22-octamethyl-6,11-dioxo-20,23-dioxahexacyclo[19.2.1.03,19.04,17.07,16.08,13]tetracosa-9,13-dien-10-yl] acetate |
| SMILES | CO[C@]12C[C@H](O[C@@H]3C[C@@]4(C)[C@@H]5CC=C6[C@@H](C=C(OC(C)=O)C(=O)C6(C)C)[C@]5(C)C(=O)C[C@]4(C)[C@@H]3[C@@H]1C)C(C)(C)O2 |
| InChI | InChI=1S/C33H46O7/c1-17-26-22(39-25-16-33(17,37-10)40-29(25,5)6)14-30(7)23-12-11-19-20(32(23,9)24(35)15-31(26,30)8)13-21(38-18(2)34)27(36)28(19,3)4/h11,13,17,20,22-23,25-26H,12,14-16H2,1-10H3/t17-,20+,22+,23-,25-,26+,30-,31+,32-,33-/m0/s1 |
| InChIKey | XCUUDIDFLXWWMB-NWCPQYPPSA-N |
| XLogP | 5.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|