About (2E,6R)-6-hydroxyocta-2,7-dien-4-one
(2E,6R)-6-hydroxyocta-2,7-dien-4-one (PubChem CID 162937710) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is (2E,6R)-6-hydroxyocta-2,7-dien-4-one.
Molecular Properties
| Compound Name | (2E,6R)-6-hydroxyocta-2,7-dien-4-one |
| PubChem CID | 162937710 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2E,6R)-6-hydroxyocta-2,7-dien-4-one |
| SMILES | C=C[C@H](O)CC(=O)/C=C/C |
| InChI | InChI=1S/C8H12O2/c1-3-5-8(10)6-7(9)4-2/h3-5,7,9H,2,6H2,1H3/b5-3+/t7-/m0/s1 |
| InChIKey | RNIXTGUNKVVQPA-MZTFZBDOSA-N |
| XLogP | 1.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6R)-6-hydroxyocta-2,7-dien-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6R)-6-hydroxyocta-2,7-dien-4-one?
The IUPAC name of (2E,6R)-6-hydroxyocta-2,7-dien-4-one (CID 162937710) is (2E,6R)-6-hydroxyocta-2,7-dien-4-one.
What is the SMILES notation for (2E,6R)-6-hydroxyocta-2,7-dien-4-one?
The canonical SMILES for (2E,6R)-6-hydroxyocta-2,7-dien-4-one is C=C[C@H](O)CC(=O)/C=C/C.
What is the InChIKey of (2E,6R)-6-hydroxyocta-2,7-dien-4-one?
The InChIKey is RNIXTGUNKVVQPA-MZTFZBDOSA-N. The full InChI is InChI=1S/C8H12O2/c1-3-5-8(10)6-7(9)4-2/h3-5,7,9H,2,6H2,1H3/b5-3+/t7-/m0/s1.
What are the key properties of (2E,6R)-6-hydroxyocta-2,7-dien-4-one?
(2E,6R)-6-hydroxyocta-2,7-dien-4-one has a molecular weight of 140.18 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6R)-6-hydroxyocta-2,7-dien-4-one is sourced from PubChem (CID 162937710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).