C13H18O2 — CID 162937861
2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-dien-8-one (PubChem CID 162937861) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-dien-8-one.
| Compound Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-dien-8-one |
|---|---|
| PubChem CID | 162937861 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]deca-3,9-dien-8-one |
| SMILES | CC1=CC(=O)CC(C)(C)C12C=CC(C)O2 |
| InChI | InChI=1S/C13H18O2/c1-9-7-11(14)8-12(3,4)13(9)6-5-10(2)15-13/h5-7,10H,8H2,1-4H3 |
| InChIKey | AYFBPOLMXLMEPR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|