C30H50 — CID 162938045
(3S,4S)-1-methyl-4-prop-1-en-2-yl-3-[(3S,7S,10E)-3,7,11,15-tetramethylhexadeca-1,10,14-trien-7-yl]cyclohexene (PubChem CID 162938045) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (3S,4S)-1-methyl-4-prop-1-en-2-yl-3-[(3S,7S,10E)-3,7,11,15-tetramethylhexadeca-1,10,14-trien-7-yl]cyclohexene.
| Compound Name | (3S,4S)-1-methyl-4-prop-1-en-2-yl-3-[(3S,7S,10E)-3,7,11,15-tetramethylhexadeca-1,10,14-trien-7-yl]cyclohexene |
|---|---|
| PubChem CID | 162938045 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (3S,4S)-1-methyl-4-prop-1-en-2-yl-3-[(3S,7S,10E)-3,7,11,15-tetramethylhexadeca-1,10,14-trien-7-yl]cyclohexene |
| SMILES | C=C[C@@H](C)CCC[C@@](C)(CC/C=C(\C)CCC=C(C)C)[C@H]1C=C(C)CC[C@@H]1C(=C)C |
| InChI | InChI=1S/C30H50/c1-10-25(6)16-12-20-30(9,21-13-17-26(7)15-11-14-23(2)3)29-22-27(8)18-19-28(29)24(4)5/h10,14,17,22,25,28-29H,1,4,11-13,15-16,18-21H2,2-3,5-9H3/b26-17+/t25-,28-,29+,30+/m1/s1 |
| InChIKey | ZJVXDMICLAHVAH-CXWIVXEJSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|