C30H36O12 — CID 162938305
[(1S,2R,4S,5R,6S,7S,12R)-4,7,12-triacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate (PubChem CID 162938305) has the molecular formula C30H36O12 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6S,7S,12R)-4,7,12-triacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate.
| Compound Name | [(1S,2R,4S,5R,6S,7S,12R)-4,7,12-triacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
|---|---|
| PubChem CID | 162938305 |
| Molecular Formula | C30H36O12 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | [(1S,2R,4S,5R,6S,7S,12R)-4,7,12-triacetyloxy-6-(acetyloxymethyl)-2,10,10-trimethyl-8-oxo-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
| SMILES | CC(=O)OC[C@]12[C@H](OC(C)=O)C(=O)C3[C@@H](OC(C)=O)[C@]1(OC3(C)C)[C@H](C)C[C@H](OC(C)=O)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36O12/c1-15-13-21(38-17(3)32)24(41-27(36)20-11-9-8-10-12-20)29(14-37-16(2)31)26(40-19(5)34)23(35)22-25(39-18(4)33)30(15,29)42-28(22,6)7/h8-12,15,21-22,24-26H,13-14H2,1-7H3/t15-,21+,22?,24+,25-,26-,29+,30-/m1/s1 |
| InChIKey | YTJZKJLJHWCAEU-RWHORTGKSA-N |
| XLogP | 2.34 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|