C34H42O11 — CID 162938408
[15-formyloxy-18-(furan-3-yl)-7,13,17-trimethyl-21-methylidene-5,10,20-trioxo-2,9-dioxapentacyclo[12.6.1.01,17.03,13.07,12]henicosan-16-yl] 2-hydroxy-3-methylpentanoate (PubChem CID 162938408) has the molecular formula C34H42O11 and a molecular weight of 626.70 g/mol. Its IUPAC name is [15-formyloxy-18-(furan-3-yl)-7,13,17-trimethyl-21-methylidene-5,10,20-trioxo-2,9-dioxapentacyclo[12.6.1.01,17.03,13.07,12]henicosan-16-yl] 2-hydroxy-3-methylpentanoate.
| Compound Name | [15-formyloxy-18-(furan-3-yl)-7,13,17-trimethyl-21-methylidene-5,10,20-trioxo-2,9-dioxapentacyclo[12.6.1.01,17.03,13.07,12]henicosan-16-yl] 2-hydroxy-3-methylpentanoate |
|---|---|
| PubChem CID | 162938408 |
| Molecular Formula | C34H42O11 |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | [15-formyloxy-18-(furan-3-yl)-7,13,17-trimethyl-21-methylidene-5,10,20-trioxo-2,9-dioxapentacyclo[12.6.1.01,17.03,13.07,12]henicosan-16-yl] 2-hydroxy-3-methylpentanoate |
| SMILES | C=C1C2C(OC=O)C(OC(=O)C(O)C(C)CC)C3(C)C(c4ccoc4)CC(=O)C13OC1CC(=O)CC3(C)COC(=O)CC3C12C |
| InChI | InChI=1S/C34H42O11/c1-7-17(2)27(39)30(40)44-29-28(43-16-35)26-18(3)34(23(37)11-21(33(29,34)6)19-8-9-41-14-19)45-24-10-20(36)13-31(4)15-42-25(38)12-22(31)32(24,26)5/h8-9,14,16-17,21-22,24,26-29,39H,3,7,10-13,15H2,1-2,4-6H3 |
| InChIKey | VKQFMPJCEQUVDZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|