C15H22O3 — CID 162939485
(1'S,3'R,3aR,5R,6aR)-1'-(hydroxymethyl)-1',3'-dimethyl-3-methylidenespiro[3a,4,6,6a-tetrahydrocyclopenta[b]furan-5,2'-cyclopentane]-2-one (PubChem CID 162939485) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1'S,3'R,3aR,5R,6aR)-1'-(hydroxymethyl)-1',3'-dimethyl-3-methylidenespiro[3a,4,6,6a-tetrahydrocyclopenta[b]furan-5,2'-cyclopentane]-2-one.
| Compound Name | (1'S,3'R,3aR,5R,6aR)-1'-(hydroxymethyl)-1',3'-dimethyl-3-methylidenespiro[3a,4,6,6a-tetrahydrocyclopenta[b]furan-5,2'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 162939485 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1'S,3'R,3aR,5R,6aR)-1'-(hydroxymethyl)-1',3'-dimethyl-3-methylidenespiro[3a,4,6,6a-tetrahydrocyclopenta[b]furan-5,2'-cyclopentane]-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C[C@]3(C[C@H]12)[C@H](C)CC[C@]3(C)CO |
| InChI | InChI=1S/C15H22O3/c1-9-4-5-14(3,8-16)15(9)6-11-10(2)13(17)18-12(11)7-15/h9,11-12,16H,2,4-8H2,1,3H3/t9-,11-,12-,14-,15-/m1/s1 |
| InChIKey | PXOQLQXFPNHKJW-LBEULSOHSA-N |
| XLogP | 2.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|