C22H26O3 — CID 162939698
6-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2-methoxynaphthalene-1,4-dione (PubChem CID 162939698) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is 6-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2-methoxynaphthalene-1,4-dione.
| Compound Name | 6-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2-methoxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 162939698 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 6-[2-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2-methoxynaphthalene-1,4-dione |
| SMILES | C=C1CCCC(C)(C)[C@H]1CCc1ccc2c(c1)C(=O)C=C(OC)C2=O |
| InChI | InChI=1S/C22H26O3/c1-14-6-5-11-22(2,3)18(14)10-8-15-7-9-16-17(12-15)19(23)13-20(25-4)21(16)24/h7,9,12-13,18H,1,5-6,8,10-11H2,2-4H3/t18-/m0/s1 |
| InChIKey | QIXSHDMCYJRFNH-SFHVURJKSA-N |
| XLogP | 4.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|