C15H24N2O2 — CID 162939756
(1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (PubChem CID 162939756) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
| Compound Name | (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
|---|---|
| PubChem CID | 162939756 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (1R,2R,9R,10R)-2-hydroxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES | O=C1CCC[C@@]2(O)[C@@H]3C[C@H](CN12)[C@H]1CCCCN1C3 |
| InChI | InChI=1S/C15H24N2O2/c18-14-5-3-6-15(19)12-8-11(9-17(14)15)13-4-1-2-7-16(13)10-12/h11-13,19H,1-10H2/t11-,12-,13-,15-/m1/s1 |
| InChIKey | GNMOLCPEHSMYLC-RGCMKSIDSA-N |
| XLogP | 1.19 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |