C30H55BrO6 — CID 162940096
(2S,3R,6S)-6-[(2R,5S)-5-bromo-2,6,6-trimethyloxan-2-yl]-2-[(4R,7R)-7-hydroxy-7-[(2S,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylheptyl]-3-methyloxan-3-ol (PubChem CID 162940096) has the molecular formula C30H55BrO6 and a molecular weight of 591.67 g/mol. Its IUPAC name is (2S,3R,6S)-6-[(2R,5S)-5-bromo-2,6,6-trimethyloxan-2-yl]-2-[(4R,7R)-7-hydroxy-7-[(2S,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylheptyl]-3-methyloxan-3-ol.
| Compound Name | (2S,3R,6S)-6-[(2R,5S)-5-bromo-2,6,6-trimethyloxan-2-yl]-2-[(4R,7R)-7-hydroxy-7-[(2S,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylheptyl]-3-methyloxan-3-ol |
|---|---|
| PubChem CID | 162940096 |
| Molecular Formula | C30H55BrO6 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | (2S,3R,6S)-6-[(2R,5S)-5-bromo-2,6,6-trimethyloxan-2-yl]-2-[(4R,7R)-7-hydroxy-7-[(2S,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-4-methylheptyl]-3-methyloxan-3-ol |
| SMILES | C[C@H](CCC[C@@H]1O[C@H]([C@@]2(C)CC[C@H](Br)C(C)(C)O2)CC[C@@]1(C)O)CC[C@@H](O)[C@]1(C)CC[C@@H](C(C)(C)O)O1 |
| InChI | InChI=1S/C30H55BrO6/c1-20(12-13-22(32)29(7)19-16-23(36-29)26(2,3)33)10-9-11-24-28(6,34)17-15-25(35-24)30(8)18-14-21(31)27(4,5)37-30/h20-25,32-34H,9-19H2,1-8H3/t20-,21+,22-,23+,24+,25+,28-,29+,30-/m1/s1 |
| InChIKey | QWXKUMIUBUIBJK-BSNNYGHRSA-N |
| XLogP | 6.05 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|