C17H24O2 — CID 162940138
(5aR,8S,9aS)-1,8-dimethyl-5a-propan-2-yl-7,8,9,9a-tetrahydro-6H-dibenzofuran-3-ol (PubChem CID 162940138) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (5aR,8S,9aS)-1,8-dimethyl-5a-propan-2-yl-7,8,9,9a-tetrahydro-6H-dibenzofuran-3-ol.
| Compound Name | (5aR,8S,9aS)-1,8-dimethyl-5a-propan-2-yl-7,8,9,9a-tetrahydro-6H-dibenzofuran-3-ol |
|---|---|
| PubChem CID | 162940138 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (5aR,8S,9aS)-1,8-dimethyl-5a-propan-2-yl-7,8,9,9a-tetrahydro-6H-dibenzofuran-3-ol |
| SMILES | Cc1cc(O)cc2c1[C@@H]1C[C@@H](C)CC[C@]1(C(C)C)O2 |
| InChI | InChI=1S/C17H24O2/c1-10(2)17-6-5-11(3)7-14(17)16-12(4)8-13(18)9-15(16)19-17/h8-11,14,18H,5-7H2,1-4H3/t11-,14-,17+/m0/s1 |
| InChIKey | ZDUXJUFDANMHKO-PZSREKOKSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |