C25H36O5 — CID 162940543
(1S,4R,8S,9R,10R,12S)-10-hydroxy-4,8,10-trimethyl-9-[(E)-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 162940543) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (1S,4R,8S,9R,10R,12S)-10-hydroxy-4,8,10-trimethyl-9-[(E)-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1S,4R,8S,9R,10R,12S)-10-hydroxy-4,8,10-trimethyl-9-[(E)-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 162940543 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (1S,4R,8S,9R,10R,12S)-10-hydroxy-4,8,10-trimethyl-9-[(E)-3-methyl-5-[(2S)-3-methyl-5-oxo-2H-furan-2-yl]pent-3-enyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | CC1=CC(=O)O[C@H]1C/C=C(\C)CC[C@@H]1[C@@]2(C)CCC[C@@]3(C)C(=O)O[C@@H](C[C@@]1(C)O)[C@@H]23 |
| InChI | InChI=1S/C25H36O5/c1-15(7-9-17-16(2)13-20(26)29-17)8-10-19-23(3)11-6-12-24(4)21(23)18(30-22(24)27)14-25(19,5)28/h7,13,17-19,21,28H,6,8-12,14H2,1-5H3/b15-7+/t17-,18-,19+,21-,23+,24+,25+/m0/s1 |
| InChIKey | YSJDJCWAZGWPOS-OKLMBCSJSA-N |
| XLogP | 4.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|