C24H28N2O6 — CID 162940582
(1S,6R,8R,11R,23R,24R,25S)-16,17-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione (PubChem CID 162940582) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is (1S,6R,8R,11R,23R,24R,25S)-16,17-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione.
| Compound Name | (1S,6R,8R,11R,23R,24R,25S)-16,17-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione |
|---|---|
| PubChem CID | 162940582 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (1S,6R,8R,11R,23R,24R,25S)-16,17-dimethoxy-4-methyl-7,10-dioxa-4,14-diazaheptacyclo[12.6.5.01,25.06,8.06,23.011,24.015,20]pentacosa-15(20),16,18-triene-13,21-dione |
| SMILES | COc1ccc2c(c1OC)N1C(=O)C[C@H]3OC[C@H]4O[C@]45CN(C)CC[C@]24C(=O)C[C@@H]5[C@@H]3[C@H]14 |
| InChI | InChI=1S/C24H28N2O6/c1-25-7-6-23-12-4-5-14(29-2)21(30-3)20(12)26-18(28)9-15-19(22(23)26)13(8-16(23)27)24(11-25)17(32-24)10-31-15/h4-5,13,15,17,19,22H,6-11H2,1-3H3/t13-,15-,17-,19+,22+,23-,24+/m1/s1 |
| InChIKey | JFBIAVWMCXUMBQ-XWAFLOPXSA-N |
| XLogP | 1.14 |
| TPSA | 80.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|