C39H62O13 — CID 162940699
7,9,13,18-tetramethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-(3,4,5-trihydroxyoxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-one (PubChem CID 162940699) has the molecular formula C39H62O13 and a molecular weight of 738.91 g/mol. Its IUPAC name is 7,9,13,18-tetramethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-(3,4,5-trihydroxyoxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-one.
| Compound Name | 7,9,13,18-tetramethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-(3,4,5-trihydroxyoxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-one |
|---|---|
| PubChem CID | 162940699 |
| Molecular Formula | C39H62O13 |
| Molecular Weight | 738.91 g/mol |
| Exact Mass | 738.42 |
| IUPAC Name | 7,9,13,18-tetramethyl-6-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-19-(3,4,5-trihydroxyoxan-2-yl)oxy-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-6-en-16-one |
| SMILES | CC1=C(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CC(OC5OCC(O)C(O)C5O)C5(C)CC(=O)CCC5(C)C4CCC3(C)C12 |
| InChI | InChI=1S/C39H62O13/c1-18(16-48-35-34(47)32(45)31(44)27(15-40)51-35)6-7-25-19(2)29-26(50-25)13-23-21-12-28(52-36-33(46)30(43)24(42)17-49-36)39(5)14-20(41)8-11-38(39,4)22(21)9-10-37(23,29)3/h18,21-24,26-36,40,42-47H,6-17H2,1-5H3 |
| InChIKey | CTHNZWSNNDXUCR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.91 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|