C17H24O3 — CID 162942022
3-(1-hydroxyethyl)-6-(3-methylbut-2-enyl)-1,3,4,5-tetrahydro-2-benzoxepin-9-ol (PubChem CID 162942022) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-(1-hydroxyethyl)-6-(3-methylbut-2-enyl)-1,3,4,5-tetrahydro-2-benzoxepin-9-ol.
| Compound Name | 3-(1-hydroxyethyl)-6-(3-methylbut-2-enyl)-1,3,4,5-tetrahydro-2-benzoxepin-9-ol |
|---|---|
| PubChem CID | 162942022 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 3-(1-hydroxyethyl)-6-(3-methylbut-2-enyl)-1,3,4,5-tetrahydro-2-benzoxepin-9-ol |
| SMILES | CC(C)=CCc1ccc(O)c2c1CCC(C(C)O)OC2 |
| InChI | InChI=1S/C17H24O3/c1-11(2)4-5-13-6-8-16(19)15-10-20-17(12(3)18)9-7-14(13)15/h4,6,8,12,17-19H,5,7,9-10H2,1-3H3 |
| InChIKey | COPHMTADRKEOGE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|