About CID 162942324
CID 162942324 (PubChem CID 162942324) has the molecular formula C31H42O3
and a molecular weight of 462.67 g/mol.
Molecular Properties
| Compound Name | CID 162942324 |
| PubChem CID | 162942324 |
| Molecular Formula | C31H42O3 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | — |
| SMILES | CO[C@H]1CC(=O)[C@H]2[C@@H]3[C@H]4CC[C@@]5(CC[C@@]6(CC[C@@H](Cc7ccccc7)C6)C5)[C@@]3(C)[C@@](C)(C4)[C@]12O |
| InChI | InChI=1S/C31H42O3/c1-27-18-22-10-12-30(28(27,2)25(22)26-23(32)16-24(34-3)31(26,27)33)14-13-29(19-30)11-9-21(17-29)15-20-7-5-4-6-8-20/h4-8,21-22,24-26,33H,9-19H2,1-3H3/t21-,22-,24-,25-,26-,27+,28+,29+,30-,31-/m0/s1 |
| InChIKey | SEVBRRPKEPMYSN-WYGDPLAJSA-N |
| XLogP | 5.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 162942324 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162942324?
The IUPAC name of CID 162942324 (CID 162942324) is not available.
What is the SMILES notation for CID 162942324?
The canonical SMILES for CID 162942324 is CO[C@H]1CC(=O)[C@H]2[C@@H]3[C@H]4CC[C@@]5(CC[C@@]6(CC[C@@H](Cc7ccccc7)C6)C5)[C@@]3(C)[C@@](C)(C4)[C@]12O.
What is the InChIKey of CID 162942324?
The InChIKey is SEVBRRPKEPMYSN-WYGDPLAJSA-N. The full InChI is InChI=1S/C31H42O3/c1-27-18-22-10-12-30(28(27,2)25(22)26-23(32)16-24(34-3)31(26,27)33)14-13-29(19-30)11-9-21(17-29)15-20-7-5-4-6-8-20/h4-8,21-22,24-26,33H,9-19H2,1-3H3/t21-,22-,24-,25-,26-,27+,28+,29+,30-,31-/m0/s1.
What are the key properties of CID 162942324?
CID 162942324 has a molecular weight of 462.67 g/mol, XLogP of 5.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162942324 is sourced from PubChem (CID 162942324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).