C20H32O3 — CID 162942973
2-[(1S,3S,5R,8S,10R,13S)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-14-yl]propan-2-ol (PubChem CID 162942973) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2-[(1S,3S,5R,8S,10R,13S)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-14-yl]propan-2-ol.
| Compound Name | 2-[(1S,3S,5R,8S,10R,13S)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-14-yl]propan-2-ol |
|---|---|
| PubChem CID | 162942973 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2-[(1S,3S,5R,8S,10R,13S)-1,5,10-trimethyl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-en-14-yl]propan-2-ol |
| SMILES | CC(C)(O)C1=CC[C@@]2(C)C[C@@H]3O[C@]3(C)CC[C@@H]3O[C@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C20H32O3/c1-17(2,21)13-6-9-18(3)12-16-20(5,23-16)11-8-15-19(4,22-15)10-7-14(13)18/h6,14-16,21H,7-12H2,1-5H3/t14-,15+,16+,18+,19-,20-/m1/s1 |
| InChIKey | AOIMAYBIPUIYPH-ZHAUUAPESA-N |
| XLogP | 3.99 |
| TPSA | 45.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|