About [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate
[(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate (PubChem CID 162943560) has the molecular formula C15H12O3S
and a molecular weight of 272.32 g/mol. Its IUPAC name is [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate.
Molecular Properties
| Compound Name | [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate |
| PubChem CID | 162943560 |
| Molecular Formula | C15H12O3S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate |
| SMILES | CC#Cc1ccc(C#CC#C[C@@H](O)COC(C)=O)s1 |
| InChI | InChI=1S/C15H12O3S/c1-3-6-14-9-10-15(19-14)8-5-4-7-13(17)11-18-12(2)16/h9-10,13,17H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | QURSDSORNAEGTR-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate?
The IUPAC name of [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate (CID 162943560) is [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate.
What is the SMILES notation for [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate?
The canonical SMILES for [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate is CC#Cc1ccc(C#CC#C[C@@H](O)COC(C)=O)s1.
What is the InChIKey of [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate?
The InChIKey is QURSDSORNAEGTR-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H12O3S/c1-3-6-14-9-10-15(19-14)8-5-4-7-13(17)11-18-12(2)16/h9-10,13,17H,11H2,1-2H3/t13-/m1/s1.
What are the key properties of [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate?
[(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate has a molecular weight of 272.32 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-hydroxy-6-(5-prop-1-ynylthiophen-2-yl)hexa-3,5-diynyl] acetate is sourced from PubChem (CID 162943560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).