C23H42O9 — CID 162943699
(2R,3R,4S,5S,6R)-2-[(E)-7-hydroxy-3,7-dimethyloct-2-enoxy]-6-[[(2R,3R,4R,5R)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 162943699) has the molecular formula C23H42O9 and a molecular weight of 462.58 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(E)-7-hydroxy-3,7-dimethyloct-2-enoxy]-6-[[(2R,3R,4R,5R)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(E)-7-hydroxy-3,7-dimethyloct-2-enoxy]-6-[[(2R,3R,4R,5R)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162943699 |
| Molecular Formula | C23H42O9 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(E)-7-hydroxy-3,7-dimethyloct-2-enoxy]-6-[[(2R,3R,4R,5R)-5-(hydroxymethyl)-3,4-dimethyloxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | C/C(=C\CO[C@@H]1O[C@H](CO[C@@H]2O[C@@H](CO)[C@H](C)[C@H]2C)[C@@H](O)[C@H](O)[C@H]1O)CCCC(C)(C)O |
| InChI | InChI=1S/C23H42O9/c1-13(7-6-9-23(4,5)28)8-10-29-22-20(27)19(26)18(25)17(32-22)12-30-21-15(3)14(2)16(11-24)31-21/h8,14-22,24-28H,6-7,9-12H2,1-5H3/b13-8+/t14-,15-,16+,17-,18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | QBTBRUNHKDMUKA-WYSXDBPOSA-N |
| XLogP | 0.70 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|