About methyl 17-methyloctadeca-5,9-dienoate
methyl 17-methyloctadeca-5,9-dienoate (PubChem CID 162943872) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is methyl 17-methyloctadeca-5,9-dienoate.
Molecular Properties
| Compound Name | methyl 17-methyloctadeca-5,9-dienoate |
| PubChem CID | 162943872 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | methyl 17-methyloctadeca-5,9-dienoate |
| SMILES | COC(=O)CCCC=CCCC=CCCCCCCC(C)C |
| InChI | InChI=1S/C20H36O2/c1-19(2)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20(21)22-3/h4-5,10,12,19H,6-9,11,13-18H2,1-3H3 |
| InChIKey | NHXSIXIFXCPYDY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 17-methyloctadeca-5,9-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 17-methyloctadeca-5,9-dienoate?
The IUPAC name of methyl 17-methyloctadeca-5,9-dienoate (CID 162943872) is methyl 17-methyloctadeca-5,9-dienoate.
What is the SMILES notation for methyl 17-methyloctadeca-5,9-dienoate?
The canonical SMILES for methyl 17-methyloctadeca-5,9-dienoate is COC(=O)CCCC=CCCC=CCCCCCCC(C)C.
What is the InChIKey of methyl 17-methyloctadeca-5,9-dienoate?
The InChIKey is NHXSIXIFXCPYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36O2/c1-19(2)17-15-13-11-9-7-5-4-6-8-10-12-14-16-18-20(21)22-3/h4-5,10,12,19H,6-9,11,13-18H2,1-3H3.
What are the key properties of methyl 17-methyloctadeca-5,9-dienoate?
methyl 17-methyloctadeca-5,9-dienoate has a molecular weight of 308.51 g/mol, XLogP of 6.22, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 17-methyloctadeca-5,9-dienoate is sourced from PubChem (CID 162943872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).