C36H66O2Si2 — CID 162943944
[(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methoxy-trimethylsilane (PubChem CID 162943944) has the molecular formula C36H66O2Si2 and a molecular weight of 587.09 g/mol. Its IUPAC name is [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methoxy-trimethylsilane.
| Compound Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 162943944 |
| Molecular Formula | C36H66O2Si2 |
| Molecular Weight | 587.09 g/mol |
| Exact Mass | 586.46 |
| IUPAC Name | [(4aS,6aR,6aS,6bR,8aR,10S,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-trimethylsilyloxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicen-4a-yl]methoxy-trimethylsilane |
| SMILES | CC1(C)CC[C@]2(CO[Si](C)(C)C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O[Si](C)(C)C)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C36H66O2Si2/c1-31(2)20-22-36(25-37-39(8,9)10)23-21-34(6)26(27(36)24-31)14-15-29-33(5)18-17-30(38-40(11,12)13)32(3,4)28(33)16-19-35(29,34)7/h14,27-30H,15-25H2,1-13H3/t27-,28-,29+,30-,33-,34+,35+,36+/m0/s1 |
| InChIKey | UUAGMUWFWZGYBW-DKXFVNHDSA-N |
| XLogP | 10.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.09 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|