C20H24N2O2 — CID 162944163
1-[(1S,9S,11S,17S,18E)-18-ethylidene-6-hydroxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]ethanone (PubChem CID 162944163) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[(1S,9S,11S,17S,18E)-18-ethylidene-6-hydroxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]ethanone.
| Compound Name | 1-[(1S,9S,11S,17S,18E)-18-ethylidene-6-hydroxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]ethanone |
|---|---|
| PubChem CID | 162944163 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-[(1S,9S,11S,17S,18E)-18-ethylidene-6-hydroxy-8,14-diazapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2(7),3,5-trien-8-yl]ethanone |
| SMILES | C/C=C1\[C@H]2CCN3CC[C@@]4(c5cccc(O)c5N(C(C)=O)[C@H]4C2)[C@H]13 |
| InChI | InChI=1S/C20H24N2O2/c1-3-14-13-7-9-21-10-8-20(19(14)21)15-5-4-6-16(24)18(15)22(12(2)23)17(20)11-13/h3-6,13,17,19,24H,7-11H2,1-2H3/b14-3+/t13-,17-,19-,20-/m0/s1 |
| InChIKey | XWAUFUXMRPCVKI-HLCJLSGSSA-N |
| XLogP | 2.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|