C20H30O2 — CID 162944188
4-methyl-1-[(2S,3S)-2-methyl-3-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]oxiran-2-yl]pent-3-en-2-one (PubChem CID 162944188) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-methyl-1-[(2S,3S)-2-methyl-3-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]oxiran-2-yl]pent-3-en-2-one.
| Compound Name | 4-methyl-1-[(2S,3S)-2-methyl-3-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]oxiran-2-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 162944188 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-methyl-1-[(2S,3S)-2-methyl-3-[(3E)-3-methyl-7-methylidenenona-3,8-dienyl]oxiran-2-yl]pent-3-en-2-one |
| SMILES | C=CC(=C)CC/C=C(\C)CC[C@@H]1O[C@@]1(C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C20H30O2/c1-7-16(4)9-8-10-17(5)11-12-19-20(6,22-19)14-18(21)13-15(2)3/h7,10,13,19H,1,4,8-9,11-12,14H2,2-3,5-6H3/b17-10+/t19-,20-/m0/s1 |
| InChIKey | QRINGOPCSWYDCI-RKBZZOKASA-N |
| XLogP | 5.32 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|