C19H32O3 — CID 162944460
[(2R,4aS,5R,8R,8aS)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylpropanoate (PubChem CID 162944460) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is [(2R,4aS,5R,8R,8aS)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylpropanoate.
| Compound Name | [(2R,4aS,5R,8R,8aS)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162944460 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | [(2R,4aS,5R,8R,8aS)-5-(2-hydroxypropan-2-yl)-3,8-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-2-yl] 2-methylpropanoate |
| SMILES | CC1=C[C@@H]2[C@@H](C[C@H]1OC(=O)C(C)C)[C@H](C)CC[C@H]2C(C)(C)O |
| InChI | InChI=1S/C19H32O3/c1-11(2)18(20)22-17-10-14-12(3)7-8-16(19(5,6)21)15(14)9-13(17)4/h9,11-12,14-17,21H,7-8,10H2,1-6H3/t12-,14+,15-,16-,17-/m1/s1 |
| InChIKey | UEBCCJACAUQNIN-GWZLXJJCSA-N |
| XLogP | 3.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|