C22H34O7 — CID 162944738
2-[(1R,2R,4R,7R,8S,12R)-8-acetyloxy-2,7-dihydroxy-1,7-dimethyl-11-methylidene-15-oxabicyclo[10.2.1]pentadecan-4-yl]prop-2-enoic acid (PubChem CID 162944738) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[(1R,2R,4R,7R,8S,12R)-8-acetyloxy-2,7-dihydroxy-1,7-dimethyl-11-methylidene-15-oxabicyclo[10.2.1]pentadecan-4-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,2R,4R,7R,8S,12R)-8-acetyloxy-2,7-dihydroxy-1,7-dimethyl-11-methylidene-15-oxabicyclo[10.2.1]pentadecan-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162944738 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(1R,2R,4R,7R,8S,12R)-8-acetyloxy-2,7-dihydroxy-1,7-dimethyl-11-methylidene-15-oxabicyclo[10.2.1]pentadecan-4-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1CC[C@@](C)(O)[C@@H](OC(C)=O)CCC(=C)[C@H]2CC[C@@](C)(O2)[C@H](O)C1 |
| InChI | InChI=1S/C22H34O7/c1-13-6-7-19(28-15(3)23)21(4,27)10-8-16(14(2)20(25)26)12-18(24)22(5)11-9-17(13)29-22/h16-19,24,27H,1-2,6-12H2,3-5H3,(H,25,26)/t16-,17-,18-,19+,21-,22-/m1/s1 |
| InChIKey | ATRGDNJWFZXSPI-SFGIZBKVSA-N |
| XLogP | 2.74 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|