C10H20O2 — CID 162944798
(3S,4S)-3,7-dimethyloct-6-ene-1,4-diol (PubChem CID 162944798) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3S,4S)-3,7-dimethyloct-6-ene-1,4-diol.
| Compound Name | (3S,4S)-3,7-dimethyloct-6-ene-1,4-diol |
|---|---|
| PubChem CID | 162944798 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (3S,4S)-3,7-dimethyloct-6-ene-1,4-diol |
| SMILES | CC(C)=CC[C@H](O)[C@@H](C)CCO |
| InChI | InChI=1S/C10H20O2/c1-8(2)4-5-10(12)9(3)6-7-11/h4,9-12H,5-7H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | NOAIKBZWOTZZQG-UWVGGRQHSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|