C13H18 — CID 162944927
(7aR)-1,4,4,7a-tetramethyl-5H-indene (PubChem CID 162944927) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (7aR)-1,4,4,7a-tetramethyl-5H-indene.
| Compound Name | (7aR)-1,4,4,7a-tetramethyl-5H-indene |
|---|---|
| PubChem CID | 162944927 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (7aR)-1,4,4,7a-tetramethyl-5H-indene |
| SMILES | CC1=CC=C2C(C)(C)CC=C[C@]12C |
| InChI | InChI=1S/C13H18/c1-10-6-7-11-12(2,3)8-5-9-13(10,11)4/h5-7,9H,8H2,1-4H3/t13-/m1/s1 |
| InChIKey | XOFDOXJFXCEFDE-CYBMUJFWSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|