C13H20O8 — CID 162945073
(3S,4S)-4-ethenyl-4-methyl-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one (PubChem CID 162945073) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is (3S,4S)-4-ethenyl-4-methyl-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one.
| Compound Name | (3S,4S)-4-ethenyl-4-methyl-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one |
|---|---|
| PubChem CID | 162945073 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3S,4S)-4-ethenyl-4-methyl-3-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-one |
| SMILES | C=C[C@@]1(C)COC(=O)[C@H]1O[C@@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H20O8/c1-3-13(2)5-19-11(18)10(13)21-12-9(17)8(16)7(15)6(4-14)20-12/h3,6-10,12,14-17H,1,4-5H2,2H3/t6-,7+,8-,9-,10+,12-,13-/m0/s1 |
| InChIKey | KOAAVBURPTWPFU-ASXBDLSUSA-N |
| XLogP | -2.08 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|