C21H30O5 — CID 162945171
7-hydroxy-11-(4-hydroxy-4-methylpent-2-enylidene)-6,7-dimethyl-2-methylidene-5,13-dioxatricyclo[8.4.0.04,6]tetradecan-12-one (PubChem CID 162945171) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 7-hydroxy-11-(4-hydroxy-4-methylpent-2-enylidene)-6,7-dimethyl-2-methylidene-5,13-dioxatricyclo[8.4.0.04,6]tetradecan-12-one.
| Compound Name | 7-hydroxy-11-(4-hydroxy-4-methylpent-2-enylidene)-6,7-dimethyl-2-methylidene-5,13-dioxatricyclo[8.4.0.04,6]tetradecan-12-one |
|---|---|
| PubChem CID | 162945171 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 7-hydroxy-11-(4-hydroxy-4-methylpent-2-enylidene)-6,7-dimethyl-2-methylidene-5,13-dioxatricyclo[8.4.0.04,6]tetradecan-12-one |
| SMILES | C=C1CC2OC2(C)C(C)(O)CCC2C(=CC=CC(C)(C)O)C(=O)OCC12 |
| InChI | InChI=1S/C21H30O5/c1-13-11-17-21(5,26-17)20(4,24)10-8-14-15(7-6-9-19(2,3)23)18(22)25-12-16(13)14/h6-7,9,14,16-17,23-24H,1,8,10-12H2,2-5H3 |
| InChIKey | FRPVQKPYVQTWOY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|