C17H18O4 — CID 162945182
[(2R,3Z,5E,11E)-2-acetyloxytrideca-3,5,11-trien-7,9-diynyl] acetate (PubChem CID 162945182) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is [(2R,3Z,5E,11E)-2-acetyloxytrideca-3,5,11-trien-7,9-diynyl] acetate.
| Compound Name | [(2R,3Z,5E,11E)-2-acetyloxytrideca-3,5,11-trien-7,9-diynyl] acetate |
|---|---|
| PubChem CID | 162945182 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(2R,3Z,5E,11E)-2-acetyloxytrideca-3,5,11-trien-7,9-diynyl] acetate |
| SMILES | C/C=C/C#CC#C/C=C/C=C\[C@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H18O4/c1-4-5-6-7-8-9-10-11-12-13-17(21-16(3)19)14-20-15(2)18/h4-5,10-13,17H,14H2,1-3H3/b5-4+,11-10+,13-12-/t17-/m1/s1 |
| InChIKey | RHZSZEGKJIYEHI-WCIQXLNGSA-N |
| XLogP | 2.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|