C22H34O4 — CID 162945421
[(1R,6R,10E,14S)-6,10,14-trimethyl-2-oxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadec-10-en-6-yl] acetate (PubChem CID 162945421) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1R,6R,10E,14S)-6,10,14-trimethyl-2-oxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadec-10-en-6-yl] acetate.
| Compound Name | [(1R,6R,10E,14S)-6,10,14-trimethyl-2-oxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadec-10-en-6-yl] acetate |
|---|---|
| PubChem CID | 162945421 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1R,6R,10E,14S)-6,10,14-trimethyl-2-oxo-3-propan-2-ylidene-15-oxabicyclo[12.1.0]pentadec-10-en-6-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)CCC/C(C)=C/CC[C@]2(C)O[C@H]2C(=O)C(=C(C)C)CC1 |
| InChI | InChI=1S/C22H34O4/c1-15(2)18-11-14-21(5,25-17(4)23)12-7-9-16(3)10-8-13-22(6)20(26-22)19(18)24/h10,20H,7-9,11-14H2,1-6H3/b16-10+/t20-,21+,22-/m0/s1 |
| InChIKey | QRIAHPSWAQTBHB-LHZPWLOLSA-N |
| XLogP | 5.06 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|