C21H20O9 — CID 162945459
methyl 2,4,5,7,12-pentahydroxy-2-methyl-6,11-dioxo-3,4,6a,10a-tetrahydro-1H-tetracene-1-carboxylate (PubChem CID 162945459) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is methyl 2,4,5,7,12-pentahydroxy-2-methyl-6,11-dioxo-3,4,6a,10a-tetrahydro-1H-tetracene-1-carboxylate.
| Compound Name | methyl 2,4,5,7,12-pentahydroxy-2-methyl-6,11-dioxo-3,4,6a,10a-tetrahydro-1H-tetracene-1-carboxylate |
|---|---|
| PubChem CID | 162945459 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | methyl 2,4,5,7,12-pentahydroxy-2-methyl-6,11-dioxo-3,4,6a,10a-tetrahydro-1H-tetracene-1-carboxylate |
| SMILES | COC(=O)C1c2c(O)c3c(c(O)c2C(O)CC1(C)O)C(=O)C1C(O)=CC=CC1C3=O |
| InChI | InChI=1S/C21H20O9/c1-21(29)6-9(23)11-12(15(21)20(28)30-2)19(27)13-14(18(11)26)17(25)10-7(16(13)24)4-3-5-8(10)22/h3-5,7,9-10,15,22-23,26-27,29H,6H2,1-2H3 |
| InChIKey | YVWJMIHCLKAVGS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|