C21H28O6 — CID 162946398
(3aS,5R,5'S,6'S,6aS)-3,3,6a-trimethyl-6'-(2-methylpropanoyl)-5'-prop-1-en-2-ylspiro[3a,4-dihydrocyclopenta[c]furan-5,3'-oxane]-1,2',6-trione (PubChem CID 162946398) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (3aS,5R,5'S,6'S,6aS)-3,3,6a-trimethyl-6'-(2-methylpropanoyl)-5'-prop-1-en-2-ylspiro[3a,4-dihydrocyclopenta[c]furan-5,3'-oxane]-1,2',6-trione.
| Compound Name | (3aS,5R,5'S,6'S,6aS)-3,3,6a-trimethyl-6'-(2-methylpropanoyl)-5'-prop-1-en-2-ylspiro[3a,4-dihydrocyclopenta[c]furan-5,3'-oxane]-1,2',6-trione |
|---|---|
| PubChem CID | 162946398 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3aS,5R,5'S,6'S,6aS)-3,3,6a-trimethyl-6'-(2-methylpropanoyl)-5'-prop-1-en-2-ylspiro[3a,4-dihydrocyclopenta[c]furan-5,3'-oxane]-1,2',6-trione |
| SMILES | C=C(C)[C@@H]1C[C@]2(C[C@@H]3C(C)(C)OC(=O)[C@]3(C)C2=O)C(=O)O[C@@H]1C(=O)C(C)C |
| InChI | InChI=1S/C21H28O6/c1-10(2)12-8-21(18(25)26-15(12)14(22)11(3)4)9-13-19(5,6)27-17(24)20(13,7)16(21)23/h11-13,15H,1,8-9H2,2-7H3/t12-,13+,15-,20-,21+/m0/s1 |
| InChIKey | NYSFQARLDYWGHP-WQHXYKAISA-N |
| XLogP | 2.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|