C16H20O5 — CID 162947065
(2S)-4-[(E)-but-2-enoyl]-2-[(1E,3E,5S)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one (PubChem CID 162947065) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2S)-4-[(E)-but-2-enoyl]-2-[(1E,3E,5S)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one.
| Compound Name | (2S)-4-[(E)-but-2-enoyl]-2-[(1E,3E,5S)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one |
|---|---|
| PubChem CID | 162947065 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (2S)-4-[(E)-but-2-enoyl]-2-[(1E,3E,5S)-5-hydroxyhexa-1,3-dienyl]-5-methoxy-2-methylfuran-3-one |
| SMILES | C/C=C/C(=O)C1=C(OC)O[C@@](C)(/C=C/C=C/[C@H](C)O)C1=O |
| InChI | InChI=1S/C16H20O5/c1-5-8-12(18)13-14(19)16(3,21-15(13)20-4)10-7-6-9-11(2)17/h5-11,17H,1-4H3/b8-5+,9-6+,10-7+/t11-,16-/m0/s1 |
| InChIKey | SDJFAZYNJXZUJT-ZIQCIEOOSA-N |
| XLogP | 1.84 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|