C26H40O8 — CID 162947236
[(3R,4S,5R,6S)-6-[2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate (PubChem CID 162947236) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-6-[2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate.
| Compound Name | [(3R,4S,5R,6S)-6-[2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 162947236 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(3R,4S,5R,6S)-6-[2-[(2R,4aR,8aR)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-yloxy]-4,5-diacetyloxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)(C)[C@@H]2CC[C@@]3(C)CCC=C(C)[C@@H]3C2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H40O8/c1-15-9-8-11-26(7)12-10-19(13-20(15)26)25(5,6)34-24-23(33-18(4)29)22(32-17(3)28)21(14-30-24)31-16(2)27/h9,19-24H,8,10-14H2,1-7H3/t19-,20+,21-,22+,23-,24+,26-/m1/s1 |
| InChIKey | VGUHLWRVJLTZOP-XOJNGUAZSA-N |
| XLogP | 4.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|