C21H30O7 — CID 162947583
[(3aS,4R,5S,5aS,6S,8aR,9S,9aS)-4-hydroxy-6-methoxy-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-9-yl] (2R)-2-methylbutanoate (PubChem CID 162947583) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(3aS,4R,5S,5aS,6S,8aR,9S,9aS)-4-hydroxy-6-methoxy-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-9-yl] (2R)-2-methylbutanoate.
| Compound Name | [(3aS,4R,5S,5aS,6S,8aR,9S,9aS)-4-hydroxy-6-methoxy-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-9-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162947583 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(3aS,4R,5S,5aS,6S,8aR,9S,9aS)-4-hydroxy-6-methoxy-5,8a-dimethyl-1-methylidene-2,8-dioxo-3a,4,5,5a,6,7,9,9a-octahydroazuleno[6,5-b]furan-9-yl] (2R)-2-methylbutanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H](O)[C@@H](C)[C@@H]3[C@@H](OC)CC(=O)[C@@]3(C)[C@@H](OC(=O)[C@H](C)CC)[C@H]12 |
| InChI | InChI=1S/C21H30O7/c1-7-9(2)19(24)28-18-14-10(3)20(25)27-17(14)16(23)11(4)15-12(26-6)8-13(22)21(15,18)5/h9,11-12,14-18,23H,3,7-8H2,1-2,4-6H3/t9-,11+,12+,14-,15-,16-,17+,18+,21-/m1/s1 |
| InChIKey | QXWHUQBDGSTZHS-HMVTVQMVSA-N |
| XLogP | 1.66 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|