C15H16O8 — CID 162948547
(4aR,6R,7R,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-3-[(4-hydroxyphenyl)methylidene]-6,7,8,8a-tetrahydro-4aH-pyrano[2,3-b][1,4]dioxin-2-one (PubChem CID 162948547) has the molecular formula C15H16O8 and a molecular weight of 324.29 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-3-[(4-hydroxyphenyl)methylidene]-6,7,8,8a-tetrahydro-4aH-pyrano[2,3-b][1,4]dioxin-2-one.
| Compound Name | (4aR,6R,7R,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-3-[(4-hydroxyphenyl)methylidene]-6,7,8,8a-tetrahydro-4aH-pyrano[2,3-b][1,4]dioxin-2-one |
|---|---|
| PubChem CID | 162948547 |
| Molecular Formula | C15H16O8 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (4aR,6R,7R,8R,8aR)-7,8-dihydroxy-6-(hydroxymethyl)-3-[(4-hydroxyphenyl)methylidene]-6,7,8,8a-tetrahydro-4aH-pyrano[2,3-b][1,4]dioxin-2-one |
| SMILES | O=C1O[C@H]2[C@@H](OC1=Cc1ccc(O)cc1)O[C@H](CO)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C15H16O8/c16-6-10-11(18)12(19)13-15(22-10)21-9(14(20)23-13)5-7-1-3-8(17)4-2-7/h1-5,10-13,15-19H,6H2/t10-,11+,12-,13-,15+/m1/s1 |
| InChIKey | SVRMKLADDRLSAP-OKWIKPQFSA-N |
| XLogP | -0.89 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|