C16H22O4 — CID 162948775
[(3aS,5aR,7R,8R,9aS,9bR)-7,9b-dimethyl-1-oxo-3,3a,5a,6,7,8,9,9a-octahydrobenzo[e][2]benzofuran-8-yl] acetate (PubChem CID 162948775) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(3aS,5aR,7R,8R,9aS,9bR)-7,9b-dimethyl-1-oxo-3,3a,5a,6,7,8,9,9a-octahydrobenzo[e][2]benzofuran-8-yl] acetate.
| Compound Name | [(3aS,5aR,7R,8R,9aS,9bR)-7,9b-dimethyl-1-oxo-3,3a,5a,6,7,8,9,9a-octahydrobenzo[e][2]benzofuran-8-yl] acetate |
|---|---|
| PubChem CID | 162948775 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(3aS,5aR,7R,8R,9aS,9bR)-7,9b-dimethyl-1-oxo-3,3a,5a,6,7,8,9,9a-octahydrobenzo[e][2]benzofuran-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@@H](C=C[C@@H]3COC(=O)[C@@]32C)C[C@H]1C |
| InChI | InChI=1S/C16H22O4/c1-9-6-11-4-5-12-8-19-15(18)16(12,3)13(11)7-14(9)20-10(2)17/h4-5,9,11-14H,6-8H2,1-3H3/t9-,11+,12-,13+,14-,16+/m1/s1 |
| InChIKey | XIFXKIDNRFETQY-TZIUIAMSSA-N |
| XLogP | 2.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|