C14H24O2 — CID 162949227
(1R,4aR,6R,7R,8aR)-4a-methyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,6-diol (PubChem CID 162949227) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1R,4aR,6R,7R,8aR)-4a-methyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,6-diol.
| Compound Name | (1R,4aR,6R,7R,8aR)-4a-methyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,6-diol |
|---|---|
| PubChem CID | 162949227 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1R,4aR,6R,7R,8aR)-4a-methyl-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-1,6-diol |
| SMILES | C=C(C)[C@H]1C[C@H]2[C@H](O)CCC[C@]2(C)C[C@H]1O |
| InChI | InChI=1S/C14H24O2/c1-9(2)10-7-11-12(15)5-4-6-14(11,3)8-13(10)16/h10-13,15-16H,1,4-8H2,2-3H3/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | BDXMGDXQTJKGNW-XVIXHAIJSA-N |
| XLogP | 2.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|